C11H13N3O4 — CID 130254940
10,12-dihydroxy-6-methyl-1,3,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione (PubChem CID 130254940) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 10,12-dihydroxy-6-methyl-1,3,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione.
| Compound Name | 10,12-dihydroxy-6-methyl-1,3,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione |
|---|---|
| PubChem CID | 130254940 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 10,12-dihydroxy-6-methyl-1,3,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione |
| SMILES | CC1CCN2Cn3cc(O)c(=O)c(O)c3C(=O)N12 |
| InChI | InChI=1S/C11H13N3O4/c1-6-2-3-13-5-12-4-7(15)9(16)10(17)8(12)11(18)14(6)13/h4,6,15,17H,2-3,5H2,1H3 |
| InChIKey | RVSKDVPOIVOOSX-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |