C13H12N2O4 — CID 137482043
(3S,4S,5R,6R)-11,13-dihydroxy-5-methyl-1,8-diazapentacyclo[8.4.0.03,8.04,6.05,7]tetradeca-10,13-diene-9,12-dione (PubChem CID 137482043) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is (3S,4S,5R,6R)-11,13-dihydroxy-5-methyl-1,8-diazapentacyclo[8.4.0.03,8.04,6.05,7]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3S,4S,5R,6R)-11,13-dihydroxy-5-methyl-1,8-diazapentacyclo[8.4.0.03,8.04,6.05,7]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 137482043 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (3S,4S,5R,6R)-11,13-dihydroxy-5-methyl-1,8-diazapentacyclo[8.4.0.03,8.04,6.05,7]tetradeca-10,13-diene-9,12-dione |
| SMILES | C[C@@]12C3[C@@H]1[C@@H]2[C@H]1Cn2cc(O)c(=O)c(O)c2C(=O)N31 |
| InChI | InChI=1S/C13H12N2O4/c1-13-6-4-2-14-3-5(16)9(17)10(18)8(14)12(19)15(4)11(13)7(6)13/h3-4,6-7,11,16,18H,2H2,1H3/t4-,6+,7+,11?,13+/m1/s1 |
| InChIKey | RXJGUGKKEKHGKX-PKTSQFGYSA-N |
| XLogP | -0.27 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |