C8H13NO — CID 142300255
(4E,5E)-4-ethylidene-5-propylidene-1,3-oxazolidine (PubChem CID 142300255) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (4E,5E)-4-ethylidene-5-propylidene-1,3-oxazolidine.
| Compound Name | (4E,5E)-4-ethylidene-5-propylidene-1,3-oxazolidine |
|---|---|
| PubChem CID | 142300255 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (4E,5E)-4-ethylidene-5-propylidene-1,3-oxazolidine |
| SMILES | C/C=C1/NCO/C1=C/CC |
| InChI | InChI=1S/C8H13NO/c1-3-5-8-7(4-2)9-6-10-8/h4-5,9H,3,6H2,1-2H3/b7-4+,8-5+ |
| InChIKey | BPFPBBXMGMREQW-NSLJXJERSA-N |
| XLogP | 1.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |