C7H9NO — CID 145267150
2,3,5,6-tetrahydro-1,3-benzoxazole (PubChem CID 145267150) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is 2,3,5,6-tetrahydro-1,3-benzoxazole.
| Compound Name | 2,3,5,6-tetrahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 145267150 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 2,3,5,6-tetrahydro-1,3-benzoxazole |
| SMILES | C1=C2NCOC2=CCC1 |
| InChI | InChI=1S/C7H9NO/c1-2-4-7-6(3-1)8-5-9-7/h3-4,8H,1-2,5H2 |
| InChIKey | BWIDQENZHVJREC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |