C10H13NO — CID 143723737
2-ethylidene-3-methyl-5,6-dihydro-1,3-benzoxazole (PubChem CID 143723737) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-ethylidene-3-methyl-5,6-dihydro-1,3-benzoxazole.
| Compound Name | 2-ethylidene-3-methyl-5,6-dihydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 143723737 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-ethylidene-3-methyl-5,6-dihydro-1,3-benzoxazole |
| SMILES | CC=C1OC2=CCCC=C2N1C |
| InChI | InChI=1S/C10H13NO/c1-3-10-11(2)8-6-4-5-7-9(8)12-10/h3,6-7H,4-5H2,1-2H3 |
| InChIKey | QNTJENAKPFLORL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |