C19H27N4O4+ — CID 142307493
trimethyl-[5-[[1-(1,2-oxazol-3-yloxy)-2-oxoheptan-3-yl]carbamoyl]-2-pyridinyl]azanium (PubChem CID 142307493) has the molecular formula C19H27N4O4+ and a molecular weight of 375.45 g/mol. Its IUPAC name is trimethyl-[5-[[1-(1,2-oxazol-3-yloxy)-2-oxoheptan-3-yl]carbamoyl]-2-pyridinyl]azanium.
| Compound Name | trimethyl-[5-[[1-(1,2-oxazol-3-yloxy)-2-oxoheptan-3-yl]carbamoyl]-2-pyridinyl]azanium |
|---|---|
| PubChem CID | 142307493 |
| Molecular Formula | C19H27N4O4+ |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | trimethyl-[5-[[1-(1,2-oxazol-3-yloxy)-2-oxoheptan-3-yl]carbamoyl]-2-pyridinyl]azanium |
| SMILES | CCCCC(NC(=O)c1ccc([N+](C)(C)C)nc1)C(=O)COc1ccon1 |
| InChI | InChI=1S/C19H26N4O4/c1-5-6-7-15(16(24)13-26-18-10-11-27-22-18)21-19(25)14-8-9-17(20-12-14)23(2,3)4/h8-12,15H,5-7,13H2,1-4H3/p+1 |
| InChIKey | FMBVTTIXGKURDO-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|