C19H18N4O2 — CID 14230964
2-[[(4-cyanoanilino)-(2,3-dihydro-1H-inden-1-ylamino)methylidene]amino]acetic acid (PubChem CID 14230964) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[[(4-cyanoanilino)-(2,3-dihydro-1H-inden-1-ylamino)methylidene]amino]acetic acid.
| Compound Name | 2-[[(4-cyanoanilino)-(2,3-dihydro-1H-inden-1-ylamino)methylidene]amino]acetic acid |
|---|---|
| PubChem CID | 14230964 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-[[(4-cyanoanilino)-(2,3-dihydro-1H-inden-1-ylamino)methylidene]amino]acetic acid |
| SMILES | N#Cc1ccc(N/C(=N\CC(=O)O)NC2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C19H18N4O2/c20-11-13-5-8-15(9-6-13)22-19(21-12-18(24)25)23-17-10-7-14-3-1-2-4-16(14)17/h1-6,8-9,17H,7,10,12H2,(H,24,25)(H2,21,22,23) |
| InChIKey | JZWXBQDAINJAMJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|