C19H19N3O — CID 25467388
2-(4-cyanoanilino)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 25467388) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-(4-cyanoanilino)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 25467388 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-(4-cyanoanilino)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | N#Cc1ccc(NCC(=O)N[C@H]2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C19H19N3O/c20-12-14-8-10-16(11-9-14)21-13-19(23)22-18-7-3-5-15-4-1-2-6-17(15)18/h1-2,4,6,8-11,18,21H,3,5,7,13H2,(H,22,23)/t18-/m0/s1 |
| InChIKey | GEDVPVWCDQZNCA-SFHVURJKSA-N |
| XLogP | 3.16 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |