C31H42FN3O4 — CID 142313653
tert-butyl 3-[2-[3-[[4-(4-ethyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]-2-fluorophenyl]ethoxy]prop-2-enoate (PubChem CID 142313653) has the molecular formula C31H42FN3O4 and a molecular weight of 539.69 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-[[4-(4-ethyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]-2-fluorophenyl]ethoxy]prop-2-enoate.
| Compound Name | tert-butyl 3-[2-[3-[[4-(4-ethyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]-2-fluorophenyl]ethoxy]prop-2-enoate |
|---|---|
| PubChem CID | 142313653 |
| Molecular Formula | C31H42FN3O4 |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | tert-butyl 3-[2-[3-[[4-(4-ethyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]-2-fluorophenyl]ethoxy]prop-2-enoate |
| SMILES | CCc1ccnc(N2CCOC3(CCN(Cc4cccc(CCOC=CC(=O)OC(C)(C)C)c4F)CC3)C2)c1 |
| InChI | InChI=1S/C31H42FN3O4/c1-5-24-9-14-33-27(21-24)35-17-20-38-31(23-35)12-15-34(16-13-31)22-26-8-6-7-25(29(26)32)10-18-37-19-11-28(36)39-30(2,3)4/h6-9,11,14,19,21H,5,10,12-13,15-18,20,22-23H2,1-4H3 |
| InChIKey | JBIYOSVSNGVWPZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|