C30H40FN3O4 — CID 162714836
tert-butyl 3-[2-[2-fluoro-3-[[4-(4-methyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethoxy]prop-2-enoate (PubChem CID 162714836) has the molecular formula C30H40FN3O4 and a molecular weight of 525.67 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-fluoro-3-[[4-(4-methyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethoxy]prop-2-enoate.
| Compound Name | tert-butyl 3-[2-[2-fluoro-3-[[4-(4-methyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethoxy]prop-2-enoate |
|---|---|
| PubChem CID | 162714836 |
| Molecular Formula | C30H40FN3O4 |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | tert-butyl 3-[2-[2-fluoro-3-[[4-(4-methyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethoxy]prop-2-enoate |
| SMILES | Cc1ccnc(N2CCOC3(CCN(Cc4cccc(CCOC=CC(=O)OC(C)(C)C)c4F)CC3)C2)c1 |
| InChI | InChI=1S/C30H40FN3O4/c1-23-8-13-32-26(20-23)34-16-19-37-30(22-34)11-14-33(15-12-30)21-25-7-5-6-24(28(25)31)9-17-36-18-10-27(35)38-29(2,3)4/h5-8,10,13,18,20H,9,11-12,14-17,19,21-22H2,1-4H3 |
| InChIKey | YEEWWAISOJHJKZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|