C23H36N2O3 — CID 142313725
1-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]pentan-3-one (PubChem CID 142313725) has the molecular formula C23H36N2O3 and a molecular weight of 388.55 g/mol. Its IUPAC name is 1-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]pentan-3-one.
| Compound Name | 1-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]pentan-3-one |
|---|---|
| PubChem CID | 142313725 |
| Molecular Formula | C23H36N2O3 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | 1-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]pentan-3-one |
| SMILES | CCC(=O)CCOCCc1cccc(CCN2CCC3(CC2)CNCCO3)c1 |
| InChI | InChI=1S/C23H36N2O3/c1-2-22(26)8-16-27-15-7-21-5-3-4-20(18-21)6-12-25-13-9-23(10-14-25)19-24-11-17-28-23/h3-5,18,24H,2,6-17,19H2,1H3 |
| InChIKey | LQDASSCHAKICHR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|