C25H40N2O4 — CID 142313723
tert-butyl 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoate (PubChem CID 142313723) has the molecular formula C25H40N2O4 and a molecular weight of 432.61 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoate |
|---|---|
| PubChem CID | 142313723 |
| Molecular Formula | C25H40N2O4 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | tert-butyl 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCc1cccc(CCN2CCC3(CC2)CNCCO3)c1 |
| InChI | InChI=1S/C25H40N2O4/c1-24(2,3)31-23(28)9-17-29-16-8-22-6-4-5-21(19-22)7-13-27-14-10-25(11-15-27)20-26-12-18-30-25/h4-6,19,26H,7-18,20H2,1-3H3 |
| InChIKey | AKIBGUSLKKDKDF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|