C29H43N3O4 — CID 142313527
tert-butyl 3-[2-[3-[[(11E,13Z)-7-oxa-3,10,16-triazaspiro[5.11]heptadeca-11,13,15-trien-3-yl]methyl]phenyl]ethoxy]propanoate (PubChem CID 142313527) has the molecular formula C29H43N3O4 and a molecular weight of 497.68 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-[[(11E,13Z)-7-oxa-3,10,16-triazaspiro[5.11]heptadeca-11,13,15-trien-3-yl]methyl]phenyl]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[3-[[(11E,13Z)-7-oxa-3,10,16-triazaspiro[5.11]heptadeca-11,13,15-trien-3-yl]methyl]phenyl]ethoxy]propanoate |
|---|---|
| PubChem CID | 142313527 |
| Molecular Formula | C29H43N3O4 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | tert-butyl 3-[2-[3-[[(11E,13Z)-7-oxa-3,10,16-triazaspiro[5.11]heptadeca-11,13,15-trien-3-yl]methyl]phenyl]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCc1cccc(CN2CCC3(CC2)C/N=C/C=C\C=C\NCCO3)c1 |
| InChI | InChI=1S/C29H43N3O4/c1-28(2,3)36-27(33)11-20-34-19-10-25-8-7-9-26(22-25)23-32-17-12-29(13-18-32)24-31-15-6-4-5-14-30-16-21-35-29/h4-9,14-15,22,30H,10-13,16-21,23-24H2,1-3H3/b6-4-,14-5+,31-15+ |
| InChIKey | OSOGHAZLRHTHQE-JDEZKERDSA-N |
| XLogP | 4.07 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|