C26H43N3O5 — CID 142313481
N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanamide (PubChem CID 142313481) has the molecular formula C26H43N3O5 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 142313481 |
| Molecular Formula | C26H43N3O5 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanamide |
| SMILES | COC(CN(C)C(=O)CCOCCc1cccc(CCN2CCC3(CC2)CNCCO3)c1)OC |
| InChI | InChI=1S/C26H43N3O5/c1-28(20-25(31-2)32-3)24(30)9-17-33-16-8-23-6-4-5-22(19-23)7-13-29-14-10-26(11-15-29)21-27-12-18-34-26/h4-6,19,25,27H,7-18,20-21H2,1-3H3 |
| InChIKey | VQPCLAPOVOLCTA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|