C35H64N2O4 — CID 142313494
N-(2,2-dimethoxyethyl)-3-[2-[3-[(4-methylpiperidin-1-yl)methyl]phenyl]ethoxy]-N-pentan-3-ylpropanamide;2,3-dimethylbut-1-ene;ethane (PubChem CID 142313494) has the molecular formula C35H64N2O4 and a molecular weight of 576.91 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3-[2-[3-[(4-methylpiperidin-1-yl)methyl]phenyl]ethoxy]-N-pentan-3-ylpropanamide;2,3-dimethylbut-1-ene;ethane.
| Compound Name | N-(2,2-dimethoxyethyl)-3-[2-[3-[(4-methylpiperidin-1-yl)methyl]phenyl]ethoxy]-N-pentan-3-ylpropanamide;2,3-dimethylbut-1-ene;ethane |
|---|---|
| PubChem CID | 142313494 |
| Molecular Formula | C35H64N2O4 |
| Molecular Weight | 576.91 g/mol |
| Exact Mass | 576.49 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3-[2-[3-[(4-methylpiperidin-1-yl)methyl]phenyl]ethoxy]-N-pentan-3-ylpropanamide;2,3-dimethylbut-1-ene;ethane |
| SMILES | C=C(C)C(C)C.CC.CCC(CC)N(CC(OC)OC)C(=O)CCOCCc1cccc(CN2CCC(C)CC2)c1 |
| InChI | InChI=1S/C27H46N2O4.C6H12.C2H6/c1-6-25(7-2)29(21-27(31-4)32-5)26(30)14-18-33-17-13-23-9-8-10-24(19-23)20-28-15-11-22(3)12-16-28;1-5(2)6(3)4;1-2/h8-10,19,22,25,27H,6-7,11-18,20-21H2,1-5H3;6H,1H2,2-4H3;1-2H3 |
| InChIKey | YQRRUNKRRWFPGQ-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.91 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|