C22H35N3O5 — CID 59290478
N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]ethoxy]propanamide (PubChem CID 59290478) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]ethoxy]propanamide.
| Compound Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 59290478 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]ethoxy]propanamide |
| SMILES | COC(CN(C(=O)CCOCCc1cccc(/C(N)=N/O)c1)C1CCCCC1)OC |
| InChI | InChI=1S/C22H35N3O5/c1-28-21(29-2)16-25(19-9-4-3-5-10-19)20(26)12-14-30-13-11-17-7-6-8-18(15-17)22(23)24-27/h6-8,15,19,21,27H,3-5,9-14,16H2,1-2H3,(H2,23,24) |
| InChIKey | LPXCPADGLVUSQK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|