C26H42N4O4 — CID 89121014
N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(1-propan-2-yl-4,5-dihydrotriazol-4-yl)phenyl]ethoxy]propanamide (PubChem CID 89121014) has the molecular formula C26H42N4O4 and a molecular weight of 474.65 g/mol. Its IUPAC name is N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(1-propan-2-yl-4,5-dihydrotriazol-4-yl)phenyl]ethoxy]propanamide.
| Compound Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(1-propan-2-yl-4,5-dihydrotriazol-4-yl)phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 89121014 |
| Molecular Formula | C26H42N4O4 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(1-propan-2-yl-4,5-dihydrotriazol-4-yl)phenyl]ethoxy]propanamide |
| SMILES | COC(CN(C(=O)CCOCCc1cccc(C2CN(C(C)C)N=N2)c1)C1CCCCC1)OC |
| InChI | InChI=1S/C26H42N4O4/c1-20(2)30-18-24(27-28-30)22-10-8-9-21(17-22)13-15-34-16-14-25(31)29(19-26(32-3)33-4)23-11-6-5-7-12-23/h8-10,17,20,23-24,26H,5-7,11-16,18-19H2,1-4H3 |
| InChIKey | SZUPIRNNSYBZFS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 75.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|