C21H33NO4 — CID 59224562
N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide (PubChem CID 59224562) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide.
| Compound Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide |
|---|---|
| PubChem CID | 59224562 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide |
| SMILES | COC(CN(C(=O)CCOCCc1ccccc1)C1CCCCC1)OC |
| InChI | InChI=1S/C21H33NO4/c1-24-21(25-2)17-22(19-11-7-4-8-12-19)20(23)14-16-26-15-13-18-9-5-3-6-10-18/h3,5-6,9-10,19,21H,4,7-8,11-17H2,1-2H3 |
| InChIKey | TZNGLXNKUHFSPJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|