C21H32FNO4 — CID 59224551
N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(4-fluorophenyl)ethoxy]propanamide (PubChem CID 59224551) has the molecular formula C21H32FNO4 and a molecular weight of 381.49 g/mol. Its IUPAC name is N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(4-fluorophenyl)ethoxy]propanamide.
| Compound Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(4-fluorophenyl)ethoxy]propanamide |
|---|---|
| PubChem CID | 59224551 |
| Molecular Formula | C21H32FNO4 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(4-fluorophenyl)ethoxy]propanamide |
| SMILES | COC(CN(C(=O)CCOCCc1ccc(F)cc1)C1CCCCC1)OC |
| InChI | InChI=1S/C21H32FNO4/c1-25-21(26-2)16-23(19-6-4-3-5-7-19)20(24)13-15-27-14-12-17-8-10-18(22)11-9-17/h8-11,19,21H,3-7,12-16H2,1-2H3 |
| InChIKey | MJIADGIDZSRZSA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|