C25H35NO4 — CID 68703797
N-(2,2-diethoxyethyl)-3-(2-phenylethoxy)-N-(2-phenylethyl)propanamide (PubChem CID 68703797) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-3-(2-phenylethoxy)-N-(2-phenylethyl)propanamide.
| Compound Name | N-(2,2-diethoxyethyl)-3-(2-phenylethoxy)-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 68703797 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | N-(2,2-diethoxyethyl)-3-(2-phenylethoxy)-N-(2-phenylethyl)propanamide |
| SMILES | CCOC(CN(CCc1ccccc1)C(=O)CCOCCc1ccccc1)OCC |
| InChI | InChI=1S/C25H35NO4/c1-3-29-25(30-4-2)21-26(18-15-22-11-7-5-8-12-22)24(27)17-20-28-19-16-23-13-9-6-10-14-23/h5-14,25H,3-4,15-21H2,1-2H3 |
| InChIKey | MCTBUPFRLUBZES-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|