C27H28N4O6 — CID 142327554
2-[5-[4-[3-(4-formylphenyl)propanoyl]piperazin-1-yl]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide (PubChem CID 142327554) has the molecular formula C27H28N4O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is 2-[5-[4-[3-(4-formylphenyl)propanoyl]piperazin-1-yl]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide.
| Compound Name | 2-[5-[4-[3-(4-formylphenyl)propanoyl]piperazin-1-yl]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 142327554 |
| Molecular Formula | C27H28N4O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 2-[5-[4-[3-(4-formylphenyl)propanoyl]piperazin-1-yl]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide |
| SMILES | NC(=O)C(CCC=O)N1C(=O)c2ccc(N3CCN(C(=O)CCc4ccc(C=O)cc4)CC3)cc2C1=O |
| InChI | InChI=1S/C27H28N4O6/c28-25(35)23(2-1-15-32)31-26(36)21-9-8-20(16-22(21)27(31)37)29-11-13-30(14-12-29)24(34)10-7-18-3-5-19(17-33)6-4-18/h3-6,8-9,15-17,23H,1-2,7,10-14H2,(H2,28,35) |
| InChIKey | UJKSDJGFOMHYTA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 138.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|