C10H14N4O10S — CID 142329703
2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfonylpropanoic acid (PubChem CID 142329703) has the molecular formula C10H14N4O10S and a molecular weight of 382.31 g/mol. Its IUPAC name is 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfonylpropanoic acid.
| Compound Name | 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfonylpropanoic acid |
|---|---|
| PubChem CID | 142329703 |
| Molecular Formula | C10H14N4O10S |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfonylpropanoic acid |
| SMILES | CC(=O)NC(CS(=O)(=O)CC(=O)N1CC([N+](=O)[O-])([N+](=O)[O-])C1)C(=O)O |
| InChI | InChI=1S/C10H14N4O10S/c1-6(15)11-7(9(17)18)2-25(23,24)3-8(16)12-4-10(5-12,13(19)20)14(21)22/h7H,2-5H2,1H3,(H,11,15)(H,17,18) |
| InChIKey | AUWAHNATYQQDTG-UHFFFAOYSA-N |
| XLogP | -2.92 |
| TPSA | 207.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|