C18H34O5Si — CID 142335970
ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyacetyl)cyclohexane-1-carboxylate (PubChem CID 142335970) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyacetyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyacetyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 142335970 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyacetyl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)COC)CCC(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H34O5Si/c1-8-22-16(20)18(15(19)13-21-5)11-9-14(10-12-18)23-24(6,7)17(2,3)4/h14H,8-13H2,1-7H3 |
| InChIKey | WYHOTMZYFJBXJF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|