C21H42O5Si — CID 15366639
ethyl 3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,8,8-trimethyl-7-oxononanoate (PubChem CID 15366639) has the molecular formula C21H42O5Si and a molecular weight of 402.65 g/mol. Its IUPAC name is ethyl 3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,8,8-trimethyl-7-oxononanoate.
| Compound Name | ethyl 3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,8,8-trimethyl-7-oxononanoate |
|---|---|
| PubChem CID | 15366639 |
| Molecular Formula | C21H42O5Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | ethyl 3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,8,8-trimethyl-7-oxononanoate |
| SMILES | CCOC(=O)CC(C)(CC(CC(=O)C(C)(C)C)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O5Si/c1-12-25-18(23)15-21(8,26-27(10,11)20(5,6)7)14-16(24-9)13-17(22)19(2,3)4/h16H,12-15H2,1-11H3 |
| InChIKey | AGRVLPYLHGQLLU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|