C12H21N3S — CID 142336264
(3aR,6aS)-6-hex-5-enyl-2-methylidene-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-3a-amine (PubChem CID 142336264) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is (3aR,6aS)-6-hex-5-enyl-2-methylidene-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-3a-amine.
| Compound Name | (3aR,6aS)-6-hex-5-enyl-2-methylidene-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-3a-amine |
|---|---|
| PubChem CID | 142336264 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (3aR,6aS)-6-hex-5-enyl-2-methylidene-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-3a-amine |
| SMILES | C=CCCCCC1SC[C@]2(N)NC(=C)N[C@H]12 |
| InChI | InChI=1S/C12H21N3S/c1-3-4-5-6-7-10-11-12(13,8-16-10)15-9(2)14-11/h3,10-11,14-15H,1-2,4-8,13H2/t10?,11-,12+/m1/s1 |
| InChIKey | DEZJDFXCTSAMIL-SAIIYOCFSA-N |
| XLogP | 1.54 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|