C10H14ClN3 — CID 142337592
5-chloro-2,6-dimethyl-[1,2,4]triazolo[1,5-a]pyridine;ethane (PubChem CID 142337592) has the molecular formula C10H14ClN3 and a molecular weight of 211.70 g/mol. Its IUPAC name is 5-chloro-2,6-dimethyl-[1,2,4]triazolo[1,5-a]pyridine;ethane.
| Compound Name | 5-chloro-2,6-dimethyl-[1,2,4]triazolo[1,5-a]pyridine;ethane |
|---|---|
| PubChem CID | 142337592 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 5-chloro-2,6-dimethyl-[1,2,4]triazolo[1,5-a]pyridine;ethane |
| SMILES | CC.Cc1nc2ccc(C)c(Cl)n2n1 |
| InChI | InChI=1S/C8H8ClN3.C2H6/c1-5-3-4-7-10-6(2)11-12(7)8(5)9;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | QXYIUCYZCYJPNU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|