C21H22N6S2 — CID 142338340
N-methyl-6-[[[6-[3-[(methylsulfanylamino)methyl]phenyl]pyrazin-2-yl]amino]methyl]-1,3-benzothiazol-2-amine (PubChem CID 142338340) has the molecular formula C21H22N6S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is N-methyl-6-[[[6-[3-[(methylsulfanylamino)methyl]phenyl]pyrazin-2-yl]amino]methyl]-1,3-benzothiazol-2-amine.
| Compound Name | N-methyl-6-[[[6-[3-[(methylsulfanylamino)methyl]phenyl]pyrazin-2-yl]amino]methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 142338340 |
| Molecular Formula | C21H22N6S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-methyl-6-[[[6-[3-[(methylsulfanylamino)methyl]phenyl]pyrazin-2-yl]amino]methyl]-1,3-benzothiazol-2-amine |
| SMILES | CNc1nc2ccc(CNc3cncc(-c4cccc(CNSC)c4)n3)cc2s1 |
| InChI | InChI=1S/C21H22N6S2/c1-22-21-27-17-7-6-15(9-19(17)29-21)10-24-20-13-23-12-18(26-20)16-5-3-4-14(8-16)11-25-28-2/h3-9,12-13,25H,10-11H2,1-2H3,(H,22,27)(H,24,26) |
| InChIKey | MJJMLSPBFYPGJY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|