C24H23B2N5S — CID 142338391
CID 142338391 (PubChem CID 142338391) has the molecular formula C24H23B2N5S and a molecular weight of 435.17 g/mol.
| Compound Name | CID 142338391 |
|---|---|
| PubChem CID | 142338391 |
| Molecular Formula | C24H23B2N5S |
| Molecular Weight | 435.17 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | — |
| SMILES | [B]C([B])(Nc1cncc(-c2ccccc2)n1)c1ccc2nc(NC3CCCCC3)sc2c1 |
| InChI | InChI=1S/C24H23B2N5S/c25-24(26,31-22-15-27-14-20(29-22)16-7-3-1-4-8-16)17-11-12-19-21(13-17)32-23(30-19)28-18-9-5-2-6-10-18/h1,3-4,7-8,11-15,18H,2,5-6,9-10H2,(H,28,30)(H,29,31) |
| InChIKey | CGEYSSWHBUROCX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.17 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|