About CID 142338391
CID 142338391 (PubChem CID 142338391) has the molecular formula C24H23B2N5S
and a molecular weight of 435.17 g/mol.
Molecular Properties
| Compound Name | CID 142338391 |
| PubChem CID | 142338391 |
| Molecular Formula | C24H23B2N5S |
| Molecular Weight | 435.17 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | — |
| SMILES | [B]C([B])(Nc1cncc(-c2ccccc2)n1)c1ccc2nc(NC3CCCCC3)sc2c1 |
| InChI | InChI=1S/C24H23B2N5S/c25-24(26,31-22-15-27-14-20(29-22)16-7-3-1-4-8-16)17-11-12-19-21(13-17)32-23(30-19)28-18-9-5-2-6-10-18/h1,3-4,7-8,11-15,18H,2,5-6,9-10H2,(H,28,30)(H,29,31) |
| InChIKey | CGEYSSWHBUROCX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.17 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 142338391 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142338391?
The IUPAC name of CID 142338391 (CID 142338391) is not available.
What is the SMILES notation for CID 142338391?
The canonical SMILES for CID 142338391 is [B]C([B])(Nc1cncc(-c2ccccc2)n1)c1ccc2nc(NC3CCCCC3)sc2c1.
What is the InChIKey of CID 142338391?
The InChIKey is CGEYSSWHBUROCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23B2N5S/c25-24(26,31-22-15-27-14-20(29-22)16-7-3-1-4-8-16)17-11-12-19-21(13-17)32-23(30-19)28-18-9-5-2-6-10-18/h1,3-4,7-8,11-15,18H,2,5-6,9-10H2,(H,28,30)(H,29,31).
What are the key properties of CID 142338391?
CID 142338391 has a molecular weight of 435.17 g/mol, XLogP of 5.06, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142338391 is sourced from PubChem (CID 142338391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).