C24H34ClFN2O4 — CID 142338577
chloromethane;4-[(2Z)-2-ethylidenepentoxy]tricyclo[4.1.0.01,3]heptane;methyl 4-(carbamoylamino)-3-fluorobenzoate (PubChem CID 142338577) has the molecular formula C24H34ClFN2O4 and a molecular weight of 469.00 g/mol. Its IUPAC name is chloromethane;4-[(2Z)-2-ethylidenepentoxy]tricyclo[4.1.0.01,3]heptane;methyl 4-(carbamoylamino)-3-fluorobenzoate.
| Compound Name | chloromethane;4-[(2Z)-2-ethylidenepentoxy]tricyclo[4.1.0.01,3]heptane;methyl 4-(carbamoylamino)-3-fluorobenzoate |
|---|---|
| PubChem CID | 142338577 |
| Molecular Formula | C24H34ClFN2O4 |
| Molecular Weight | 469.00 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | chloromethane;4-[(2Z)-2-ethylidenepentoxy]tricyclo[4.1.0.01,3]heptane;methyl 4-(carbamoylamino)-3-fluorobenzoate |
| SMILES | C/C=C(/CCC)COC1CC2CC23CC13.CCl.COC(=O)c1ccc(NC(N)=O)c(F)c1 |
| InChI | InChI=1S/C14H22O.C9H9FN2O3.CH3Cl/c1-3-5-10(4-2)9-15-13-6-11-7-14(11)8-12(13)14;1-15-8(13)5-2-3-7(6(10)4-5)12-9(11)14;1-2/h4,11-13H,3,5-9H2,1-2H3;2-4H,1H3,(H3,11,12,14);1H3/b10-4-;; |
| InChIKey | JGGQYMDBQSLXSH-QZCHPNKRSA-N |
| XLogP | 5.51 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.00 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|