C11H15N3O2 — CID 142339281
propyl N-[amino-(4-aminophenyl)methylidene]carbamate (PubChem CID 142339281) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is propyl N-[amino-(4-aminophenyl)methylidene]carbamate.
| Compound Name | propyl N-[amino-(4-aminophenyl)methylidene]carbamate |
|---|---|
| PubChem CID | 142339281 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | propyl N-[amino-(4-aminophenyl)methylidene]carbamate |
| SMILES | CCCOC(=O)N=C(N)c1ccc(N)cc1 |
| InChI | InChI=1S/C11H15N3O2/c1-2-7-16-11(15)14-10(13)8-3-5-9(12)6-4-8/h3-6H,2,7,12H2,1H3,(H2,13,14,15) |
| InChIKey | HWRCHYMRNAHZDH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|