C16H23N3O4 — CID 158832773
2-[[amino-(4-aminophenyl)methylidene]carbamoyloxy]ethyl (2S)-2,3-dimethylbutanoate (PubChem CID 158832773) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[[amino-(4-aminophenyl)methylidene]carbamoyloxy]ethyl (2S)-2,3-dimethylbutanoate.
| Compound Name | 2-[[amino-(4-aminophenyl)methylidene]carbamoyloxy]ethyl (2S)-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 158832773 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-[[amino-(4-aminophenyl)methylidene]carbamoyloxy]ethyl (2S)-2,3-dimethylbutanoate |
| SMILES | CC(C)[C@H](C)C(=O)OCCOC(=O)N=C(N)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H23N3O4/c1-10(2)11(3)15(20)22-8-9-23-16(21)19-14(18)12-4-6-13(17)7-5-12/h4-7,10-11H,8-9,17H2,1-3H3,(H2,18,19,21)/t11-/m0/s1 |
| InChIKey | DIRPPZKKUDIWIN-NSHDSACASA-N |
| XLogP | 1.95 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|