C8H12N2S — CID 142340346
1-cyclohexa-1,5-dien-1-yl-3-methylthiourea (PubChem CID 142340346) has the molecular formula C8H12N2S and a molecular weight of 168.26 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-3-methylthiourea.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-3-methylthiourea |
|---|---|
| PubChem CID | 142340346 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-3-methylthiourea |
| SMILES | CNC(=S)NC1=CCCC=C1 |
| InChI | InChI=1S/C8H12N2S/c1-9-8(11)10-7-5-3-2-4-6-7/h3,5-6H,2,4H2,1H3,(H2,9,10,11) |
| InChIKey | DQUITIXRVNHHMB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|