C23H16F5N3O3S — CID 142341543
[6-[(4S)-7-(2,6-difluorophenyl)-8,9-diazatetracyclo[9.1.1.02,4.05,10]trideca-5,7,9-trien-11-yl]-2-pyridinyl] trifluoromethanesulfonate (PubChem CID 142341543) has the molecular formula C23H16F5N3O3S and a molecular weight of 509.46 g/mol. Its IUPAC name is [6-[(4S)-7-(2,6-difluorophenyl)-8,9-diazatetracyclo[9.1.1.02,4.05,10]trideca-5,7,9-trien-11-yl]-2-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [6-[(4S)-7-(2,6-difluorophenyl)-8,9-diazatetracyclo[9.1.1.02,4.05,10]trideca-5,7,9-trien-11-yl]-2-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142341543 |
| Molecular Formula | C23H16F5N3O3S |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | [6-[(4S)-7-(2,6-difluorophenyl)-8,9-diazatetracyclo[9.1.1.02,4.05,10]trideca-5,7,9-trien-11-yl]-2-pyridinyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cccc(C23CC(C2)C2C[C@@H]2c2cc(-c4c(F)cccc4F)nnc23)n1)C(F)(F)F |
| InChI | InChI=1S/C23H16F5N3O3S/c24-15-3-1-4-16(25)20(15)17-8-14-13-7-12(13)11-9-22(10-11,21(14)31-30-17)18-5-2-6-19(29-18)34-35(32,33)23(26,27)28/h1-6,8,11-13H,7,9-10H2/t11?,12?,13-,22?/m0/s1 |
| InChIKey | CIOQXLFPBFPVSQ-CDDOHDJSSA-N |
| XLogP | 4.86 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|