C22H20F4N4O — CID 144841695
2-[2,2-difluoroethyl-[[(2R,8S)-11-(2,6-difluorophenyl)-12,13-diazapentacyclo[7.4.0.02,4.03,6.05,8]trideca-1(13),9,11-trien-2-yl]methyl]amino]acetamide (PubChem CID 144841695) has the molecular formula C22H20F4N4O and a molecular weight of 432.42 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-[[(2R,8S)-11-(2,6-difluorophenyl)-12,13-diazapentacyclo[7.4.0.02,4.03,6.05,8]trideca-1(13),9,11-trien-2-yl]methyl]amino]acetamide.
| Compound Name | 2-[2,2-difluoroethyl-[[(2R,8S)-11-(2,6-difluorophenyl)-12,13-diazapentacyclo[7.4.0.02,4.03,6.05,8]trideca-1(13),9,11-trien-2-yl]methyl]amino]acetamide |
|---|---|
| PubChem CID | 144841695 |
| Molecular Formula | C22H20F4N4O |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[2,2-difluoroethyl-[[(2R,8S)-11-(2,6-difluorophenyl)-12,13-diazapentacyclo[7.4.0.02,4.03,6.05,8]trideca-1(13),9,11-trien-2-yl]methyl]amino]acetamide |
| SMILES | NC(=O)CN(CC(F)F)C[C@]12c3nnc(-c4c(F)cccc4F)cc3C3CC4C3C1C42 |
| InChI | InChI=1S/C22H20F4N4O/c23-12-2-1-3-13(24)18(12)14-5-10-9-4-11-17(9)20-19(11)22(20,21(10)29-28-14)8-30(6-15(25)26)7-16(27)31/h1-3,5,9,11,15,17,19-20H,4,6-8H2,(H2,27,31)/t9?,11?,17?,19?,20?,22-/m1/s1 |
| InChIKey | IRLXOWUYIYJVFT-IUEFTDACSA-N |
| XLogP | 2.70 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |