C25H21Cl2F2N5O3 — CID 142342837
2-chloro-N-[2-[[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]amino]-2-oxoethyl]-2-fluoroacetamide;4-methylphenol (PubChem CID 142342837) has the molecular formula C25H21Cl2F2N5O3 and a molecular weight of 548.38 g/mol. Its IUPAC name is 2-chloro-N-[2-[[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]amino]-2-oxoethyl]-2-fluoroacetamide;4-methylphenol.
| Compound Name | 2-chloro-N-[2-[[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]amino]-2-oxoethyl]-2-fluoroacetamide;4-methylphenol |
|---|---|
| PubChem CID | 142342837 |
| Molecular Formula | C25H21Cl2F2N5O3 |
| Molecular Weight | 548.38 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 2-chloro-N-[2-[[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]amino]-2-oxoethyl]-2-fluoroacetamide;4-methylphenol |
| SMILES | Cc1ccc(O)cc1.O=C(CNC(=O)C(F)Cl)Nc1ccc2ncnc(Nc3ccc(F)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C18H13Cl2F2N5O2.C7H8O/c19-12-6-10(1-3-13(12)21)27-17-11-5-9(2-4-14(11)24-8-25-17)26-15(28)7-23-18(29)16(20)22;1-6-2-4-7(8)5-3-6/h1-6,8,16H,7H2,(H,23,29)(H,26,28)(H,24,25,27);2-5,8H,1H3 |
| InChIKey | NKMIQPRSVCOJGY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|