C26H26ClF3N4O3S — CID 142344875
1-[[1-[2-[2-chloro-N-phenylsulfanyl-5-(trifluoromethyl)anilino]acetyl]piperidin-3-yl]methyl]-5-methylpyrimidine-2,4-dione (PubChem CID 142344875) has the molecular formula C26H26ClF3N4O3S and a molecular weight of 567.03 g/mol. Its IUPAC name is 1-[[1-[2-[2-chloro-N-phenylsulfanyl-5-(trifluoromethyl)anilino]acetyl]piperidin-3-yl]methyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[[1-[2-[2-chloro-N-phenylsulfanyl-5-(trifluoromethyl)anilino]acetyl]piperidin-3-yl]methyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142344875 |
| Molecular Formula | C26H26ClF3N4O3S |
| Molecular Weight | 567.03 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 1-[[1-[2-[2-chloro-N-phenylsulfanyl-5-(trifluoromethyl)anilino]acetyl]piperidin-3-yl]methyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(CC2CCCN(C(=O)CN(Sc3ccccc3)c3cc(C(F)(F)F)ccc3Cl)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H26ClF3N4O3S/c1-17-13-33(25(37)31-24(17)36)15-18-6-5-11-32(14-18)23(35)16-34(38-20-7-3-2-4-8-20)22-12-19(26(28,29)30)9-10-21(22)27/h2-4,7-10,12-13,18H,5-6,11,14-16H2,1H3,(H,31,36,37) |
| InChIKey | HXEKXWFOGPGKQC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.03 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|