C14H17N5 — CID 142345879
1-cyclopentyl-4,5-dihydropyrazolo[4,5-h]quinazolin-8-amine (PubChem CID 142345879) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-cyclopentyl-4,5-dihydropyrazolo[4,5-h]quinazolin-8-amine.
| Compound Name | 1-cyclopentyl-4,5-dihydropyrazolo[4,5-h]quinazolin-8-amine |
|---|---|
| PubChem CID | 142345879 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 1-cyclopentyl-4,5-dihydropyrazolo[4,5-h]quinazolin-8-amine |
| SMILES | Nc1ncc2c(n1)-c1c(cnn1C1CCCC1)CC2 |
| InChI | InChI=1S/C14H17N5/c15-14-16-7-9-5-6-10-8-17-19(11-3-1-2-4-11)13(10)12(9)18-14/h7-8,11H,1-6H2,(H2,15,16,18) |
| InChIKey | UPZWJFWNCMDCEU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |