C10H11N5 — CID 167015903
1-methyl-4,5-dihydroimidazo[4,5-h]quinazolin-8-amine (PubChem CID 167015903) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-methyl-4,5-dihydroimidazo[4,5-h]quinazolin-8-amine.
| Compound Name | 1-methyl-4,5-dihydroimidazo[4,5-h]quinazolin-8-amine |
|---|---|
| PubChem CID | 167015903 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-methyl-4,5-dihydroimidazo[4,5-h]quinazolin-8-amine |
| SMILES | Cn1cnc2c1-c1nc(N)ncc1CC2 |
| InChI | InChI=1S/C10H11N5/c1-15-5-13-7-3-2-6-4-12-10(11)14-8(6)9(7)15/h4-5H,2-3H2,1H3,(H2,11,12,14) |
| InChIKey | IKZPVSJYJMBOEZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |