C12H12N4O2 — CID 174691491
(2-amino-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate (PubChem CID 174691491) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is (2-amino-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate.
| Compound Name | (2-amino-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate |
|---|---|
| PubChem CID | 174691491 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (2-amino-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate |
| SMILES | CC(=O)Oc1c[nH]c2c1CCc1cnc(N)nc1-2 |
| InChI | InChI=1S/C12H12N4O2/c1-6(17)18-9-5-14-11-8(9)3-2-7-4-15-12(13)16-10(7)11/h4-5,14H,2-3H2,1H3,(H2,13,15,16) |
| InChIKey | XTHYRYBAUSZEOE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |