2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid

C11H9N3O2S — CID 163287315

IUPAC2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid
SMILESNc1ncc2c(n1)-c1cc(C(=O)O)sc1CC2
InChIInChI=1S/C11H9N3O2S/c12-11-13-4-5-1-2-7-6(9(5)14-11)3-8(17-7)10(15)16/h3-4H,1-2H2,(H,15,16)(H2,12,13,14)
InChIKeyJOENDDXMDJJIAV-UHFFFAOYSA-N
MW247.28 g/mol
LogP1.58
Rot. Bonds1

About 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid

2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid (PubChem CID 163287315) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid.

Molecular Properties

Compound Name2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid
PubChem CID163287315
Molecular FormulaC11H9N3O2S
Molecular Weight247.28 g/mol
Exact Mass247.04
IUPAC Name2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid
SMILESNc1ncc2c(n1)-c1cc(C(=O)O)sc1CC2
InChIInChI=1S/C11H9N3O2S/c12-11-13-4-5-1-2-7-6(9(5)14-11)3-8(17-7)10(15)16/h3-4H,1-2H2,(H,15,16)(H2,12,13,14)
InChIKeyJOENDDXMDJJIAV-UHFFFAOYSA-N
XLogP1.58
TPSA89.10 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.28
LogP ≤ 51.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid?
The IUPAC name of 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid (CID 163287315) is 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid.
What is the SMILES notation for 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid?
The canonical SMILES for 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid is Nc1ncc2c(n1)-c1cc(C(=O)O)sc1CC2.
What is the InChIKey of 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid?
The InChIKey is JOENDDXMDJJIAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O2S/c12-11-13-4-5-1-2-7-6(9(5)14-11)3-8(17-7)10(15)16/h3-4H,1-2H2,(H,15,16)(H2,12,13,14).
What are the key properties of 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid?
2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid has a molecular weight of 247.28 g/mol, XLogP of 1.58, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid is sourced from PubChem (CID 163287315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).