C11H9N3O2S — CID 163287315
2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid (PubChem CID 163287315) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid.
| Compound Name | 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid |
|---|---|
| PubChem CID | 163287315 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2-amino-5,6-dihydrothieno[2,3-h]quinazoline-8-carboxylic acid |
| SMILES | Nc1ncc2c(n1)-c1cc(C(=O)O)sc1CC2 |
| InChI | InChI=1S/C11H9N3O2S/c12-11-13-4-5-1-2-7-6(9(5)14-11)3-8(17-7)10(15)16/h3-4H,1-2H2,(H,15,16)(H2,12,13,14) |
| InChIKey | JOENDDXMDJJIAV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |