C17H18N6O3 — CID 142346186
7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethyltriazolo[4,5-c]pyridin-4-one (PubChem CID 142346186) has the molecular formula C17H18N6O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethyltriazolo[4,5-c]pyridin-4-one.
| Compound Name | 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethyltriazolo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 142346186 |
| Molecular Formula | C17H18N6O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethyltriazolo[4,5-c]pyridin-4-one |
| SMILES | Cn1nc2c(-c3cc([N+](=O)[O-])ccc3NCC3CC3)cn(C)c(=O)c2n1 |
| InChI | InChI=1S/C17H18N6O3/c1-21-9-13(15-16(17(21)24)20-22(2)19-15)12-7-11(23(25)26)5-6-14(12)18-8-10-3-4-10/h5-7,9-10,18H,3-4,8H2,1-2H3 |
| InChIKey | VGNFZWGOMJERDT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|