C9H13F2N — CID 142348700
(3Z)-3,4-difluoro-6-methyl-5-methylidenehepta-1,3-dien-2-amine (PubChem CID 142348700) has the molecular formula C9H13F2N and a molecular weight of 173.21 g/mol. Its IUPAC name is (3Z)-3,4-difluoro-6-methyl-5-methylidenehepta-1,3-dien-2-amine.
| Compound Name | (3Z)-3,4-difluoro-6-methyl-5-methylidenehepta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 142348700 |
| Molecular Formula | C9H13F2N |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | (3Z)-3,4-difluoro-6-methyl-5-methylidenehepta-1,3-dien-2-amine |
| SMILES | C=C(N)/C(F)=C(/F)C(=C)C(C)C |
| InChI | InChI=1S/C9H13F2N/c1-5(2)6(3)8(10)9(11)7(4)12/h5H,3-4,12H2,1-2H3/b9-8- |
| InChIKey | OHKWFVCJPRVYPL-HJWRWDBZSA-N |
| XLogP | 2.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|