C11H15N3 — CID 142349281
6-piperazin-1-ylcyclohexa-1,5-diene-1-carbonitrile (PubChem CID 142349281) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 6-piperazin-1-ylcyclohexa-1,5-diene-1-carbonitrile.
| Compound Name | 6-piperazin-1-ylcyclohexa-1,5-diene-1-carbonitrile |
|---|---|
| PubChem CID | 142349281 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 6-piperazin-1-ylcyclohexa-1,5-diene-1-carbonitrile |
| SMILES | N#CC1=CCCC=C1N1CCNCC1 |
| InChI | InChI=1S/C11H15N3/c12-9-10-3-1-2-4-11(10)14-7-5-13-6-8-14/h3-4,13H,1-2,5-8H2 |
| InChIKey | XLFQPSRDYLXNSF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |