C12H16N2 — CID 123864361
1-(3,4-dimethylidenecyclohexa-1,5-dien-1-yl)piperazine (PubChem CID 123864361) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-(3,4-dimethylidenecyclohexa-1,5-dien-1-yl)piperazine.
| Compound Name | 1-(3,4-dimethylidenecyclohexa-1,5-dien-1-yl)piperazine |
|---|---|
| PubChem CID | 123864361 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-(3,4-dimethylidenecyclohexa-1,5-dien-1-yl)piperazine |
| SMILES | C=c1ccc(N2CCNCC2)cc1=C |
| InChI | InChI=1S/C12H16N2/c1-10-3-4-12(9-11(10)2)14-7-5-13-6-8-14/h3-4,9,13H,1-2,5-8H2 |
| InChIKey | ZVDMQCNQJCDOPC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |