About ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine
ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine (PubChem CID 142167043) has the molecular formula C13H21F3N2
and a molecular weight of 262.32 g/mol. Its IUPAC name is ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine.
Molecular Properties
| Compound Name | ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine |
| PubChem CID | 142167043 |
| Molecular Formula | C13H21F3N2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine |
| SMILES | CC.FC(F)(F)C1=CC(N2CCNCC2)=CCC1 |
| InChI | InChI=1S/C11H15F3N2.C2H6/c12-11(13,14)9-2-1-3-10(8-9)16-6-4-15-5-7-16;1-2/h3,8,15H,1-2,4-7H2;1-2H3 |
| InChIKey | XNOZBJALEKYCBL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine?
The IUPAC name of ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine (CID 142167043) is ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine.
What is the SMILES notation for ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine?
The canonical SMILES for ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine is CC.FC(F)(F)C1=CC(N2CCNCC2)=CCC1.
What is the InChIKey of ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine?
The InChIKey is XNOZBJALEKYCBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3N2.C2H6/c12-11(13,14)9-2-1-3-10(8-9)16-6-4-15-5-7-16;1-2/h3,8,15H,1-2,4-7H2;1-2H3.
What are the key properties of ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine?
ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine has a molecular weight of 262.32 g/mol, XLogP of 3.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine is sourced from PubChem (CID 142167043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).