About ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile
ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile (PubChem CID 142349299) has the molecular formula C12H19N3
and a molecular weight of 205.30 g/mol. Its IUPAC name is ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile.
Molecular Properties
| Compound Name | ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile |
| PubChem CID | 142349299 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile |
| SMILES | C=C.C=C(C#N)/C(=C\C)N1CCNCC1 |
| InChI | InChI=1S/C10H15N3.C2H4/c1-3-10(9(2)8-11)13-6-4-12-5-7-13;1-2/h3,12H,2,4-7H2,1H3;1-2H2/b10-3+; |
| InChIKey | ALEZWHKEVWCSQP-ORVWSRSGSA-N |
| XLogP | 1.68 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile?
The IUPAC name of ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile (CID 142349299) is ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile.
What is the SMILES notation for ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile?
The canonical SMILES for ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile is C=C.C=C(C#N)/C(=C\C)N1CCNCC1.
What is the InChIKey of ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile?
The InChIKey is ALEZWHKEVWCSQP-ORVWSRSGSA-N. The full InChI is InChI=1S/C10H15N3.C2H4/c1-3-10(9(2)8-11)13-6-4-12-5-7-13;1-2/h3,12H,2,4-7H2,1H3;1-2H2/b10-3+;.
What are the key properties of ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile?
ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile has a molecular weight of 205.30 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;(E)-2-methylidene-3-piperazin-1-ylpent-3-enenitrile is sourced from PubChem (CID 142349299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).