C21H22O10 — CID 142352741
ethane;6-[3-methyl-5-(2,3,4,5,6-pentahydroxyphenyl)phenyl]benzene-1,2,3,4,5-pentol (PubChem CID 142352741) has the molecular formula C21H22O10 and a molecular weight of 434.40 g/mol. Its IUPAC name is ethane;6-[3-methyl-5-(2,3,4,5,6-pentahydroxyphenyl)phenyl]benzene-1,2,3,4,5-pentol.
| Compound Name | ethane;6-[3-methyl-5-(2,3,4,5,6-pentahydroxyphenyl)phenyl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 142352741 |
| Molecular Formula | C21H22O10 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | ethane;6-[3-methyl-5-(2,3,4,5,6-pentahydroxyphenyl)phenyl]benzene-1,2,3,4,5-pentol |
| SMILES | CC.Cc1cc(-c2c(O)c(O)c(O)c(O)c2O)cc(-c2c(O)c(O)c(O)c(O)c2O)c1 |
| InChI | InChI=1S/C19H16O10.C2H6/c1-5-2-6(8-10(20)14(24)18(28)15(25)11(8)21)4-7(3-5)9-12(22)16(26)19(29)17(27)13(9)23;1-2/h2-4,20-29H,1H3;1-2H3 |
| InChIKey | XPWNKPXXOCVJAW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|