C26H45N3 — CID 142354965
N-[[(Z)-[(Z,3Z)-4-[1-[(4Z)-3-ethylhexa-1,4-dien-2-yl]piperidin-4-yl]-3-ethylidenehex-4-en-2-ylidene]amino]methyl]butan-1-amine (PubChem CID 142354965) has the molecular formula C26H45N3 and a molecular weight of 399.67 g/mol. Its IUPAC name is N-[[(Z)-[(Z,3Z)-4-[1-[(4Z)-3-ethylhexa-1,4-dien-2-yl]piperidin-4-yl]-3-ethylidenehex-4-en-2-ylidene]amino]methyl]butan-1-amine.
| Compound Name | N-[[(Z)-[(Z,3Z)-4-[1-[(4Z)-3-ethylhexa-1,4-dien-2-yl]piperidin-4-yl]-3-ethylidenehex-4-en-2-ylidene]amino]methyl]butan-1-amine |
|---|---|
| PubChem CID | 142354965 |
| Molecular Formula | C26H45N3 |
| Molecular Weight | 399.67 g/mol |
| Exact Mass | 399.36 |
| IUPAC Name | N-[[(Z)-[(Z,3Z)-4-[1-[(4Z)-3-ethylhexa-1,4-dien-2-yl]piperidin-4-yl]-3-ethylidenehex-4-en-2-ylidene]amino]methyl]butan-1-amine |
| SMILES | C=C(C(/C=C\C)CC)N1CCC(C(=C/C)/C(=C/C)C(/C)=N\CNCCCC)CC1 |
| InChI | InChI=1S/C26H45N3/c1-8-13-17-27-20-28-21(6)25(11-4)26(12-5)24-15-18-29(19-16-24)22(7)23(10-3)14-9-2/h9,11-12,14,23-24,27H,7-8,10,13,15-20H2,1-6H3/b14-9-,25-11+,26-12-,28-21- |
| InChIKey | XDFWEYUVHDQOKU-MKWOGXHZSA-N |
| XLogP | 6.52 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.67 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|