C29H38O8Si — CID 142355047
4-[[4-[[4-(2-methylpropanoyloxy)phenyl]methoxycarbonyl]phenyl]methyl]-5-oxo-5-(2-trimethylsilylethoxy)pentanoic acid (PubChem CID 142355047) has the molecular formula C29H38O8Si and a molecular weight of 542.70 g/mol. Its IUPAC name is 4-[[4-[[4-(2-methylpropanoyloxy)phenyl]methoxycarbonyl]phenyl]methyl]-5-oxo-5-(2-trimethylsilylethoxy)pentanoic acid.
| Compound Name | 4-[[4-[[4-(2-methylpropanoyloxy)phenyl]methoxycarbonyl]phenyl]methyl]-5-oxo-5-(2-trimethylsilylethoxy)pentanoic acid |
|---|---|
| PubChem CID | 142355047 |
| Molecular Formula | C29H38O8Si |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 4-[[4-[[4-(2-methylpropanoyloxy)phenyl]methoxycarbonyl]phenyl]methyl]-5-oxo-5-(2-trimethylsilylethoxy)pentanoic acid |
| SMILES | CC(C)C(=O)Oc1ccc(COC(=O)c2ccc(CC(CCC(=O)O)C(=O)OCC[Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H38O8Si/c1-20(2)27(32)37-25-13-8-22(9-14-25)19-36-28(33)23-10-6-21(7-11-23)18-24(12-15-26(30)31)29(34)35-16-17-38(3,4)5/h6-11,13-14,20,24H,12,15-19H2,1-5H3,(H,30,31) |
| InChIKey | YNSHCOIJDUDYTC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|