C25H38O6Si — CID 153280637
2-trimethylsilylethyl 2-[[4-(3-propan-2-yloxycarbonyloxypropanoyl)phenyl]methyl]hex-5-enoate (PubChem CID 153280637) has the molecular formula C25H38O6Si and a molecular weight of 462.66 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[[4-(3-propan-2-yloxycarbonyloxypropanoyl)phenyl]methyl]hex-5-enoate.
| Compound Name | 2-trimethylsilylethyl 2-[[4-(3-propan-2-yloxycarbonyloxypropanoyl)phenyl]methyl]hex-5-enoate |
|---|---|
| PubChem CID | 153280637 |
| Molecular Formula | C25H38O6Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 2-trimethylsilylethyl 2-[[4-(3-propan-2-yloxycarbonyloxypropanoyl)phenyl]methyl]hex-5-enoate |
| SMILES | C=CCCC(Cc1ccc(C(=O)CCOC(=O)OC(C)C)cc1)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C25H38O6Si/c1-7-8-9-22(24(27)29-16-17-32(4,5)6)18-20-10-12-21(13-11-20)23(26)14-15-30-25(28)31-19(2)3/h7,10-13,19,22H,1,8-9,14-18H2,2-6H3 |
| InChIKey | PNYFXXVOCTXUKH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|